C23H37N2O3+ — CID 58914428
[2,6-di(propan-2-yl)phenyl] 4-oxo-4-(2-piperidin-1-ium-1-ylethylamino)butanoate (PubChem CID 58914428) has the molecular formula C23H37N2O3+ and a molecular weight of 389.56 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 4-oxo-4-(2-piperidin-1-ium-1-ylethylamino)butanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 4-oxo-4-(2-piperidin-1-ium-1-ylethylamino)butanoate |
|---|---|
| PubChem CID | 58914428 |
| Molecular Formula | C23H37N2O3+ |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 4-oxo-4-(2-piperidin-1-ium-1-ylethylamino)butanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)CCC(=O)NCC[NH+]1CCCCC1 |
| InChI | InChI=1S/C23H36N2O3/c1-17(2)19-9-8-10-20(18(3)4)23(19)28-22(27)12-11-21(26)24-13-16-25-14-6-5-7-15-25/h8-10,17-18H,5-7,11-16H2,1-4H3,(H,24,26)/p+1 |
| InChIKey | IKVQVEWFTIPPJY-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|