C24H43N3O3S — CID 18988684
2-(dioctylsulfamoyl)-N-(3-methyl-2-pyridinyl)acetamide (PubChem CID 18988684) has the molecular formula C24H43N3O3S and a molecular weight of 453.69 g/mol. Its IUPAC name is 2-(dioctylsulfamoyl)-N-(3-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-(dioctylsulfamoyl)-N-(3-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 18988684 |
| Molecular Formula | C24H43N3O3S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 2-(dioctylsulfamoyl)-N-(3-methyl-2-pyridinyl)acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)S(=O)(=O)CC(=O)Nc1ncccc1C |
| InChI | InChI=1S/C24H43N3O3S/c1-4-6-8-10-12-14-19-27(20-15-13-11-9-7-5-2)31(29,30)21-23(28)26-24-22(3)17-16-18-25-24/h16-18H,4-15,19-21H2,1-3H3,(H,25,26,28) |
| InChIKey | DDDUHWYYNHUHHY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|