C21H36N3NaO3S — CID 10694102
sodium dibutylsulfamoyl-[[2,6-di(propan-2-yl)phenyl]carbamoyl]azanide (PubChem CID 10694102) has the molecular formula C21H36N3NaO3S and a molecular weight of 433.59 g/mol. Its IUPAC name is sodium dibutylsulfamoyl-[[2,6-di(propan-2-yl)phenyl]carbamoyl]azanide.
| Compound Name | sodium dibutylsulfamoyl-[[2,6-di(propan-2-yl)phenyl]carbamoyl]azanide |
|---|---|
| PubChem CID | 10694102 |
| Molecular Formula | C21H36N3NaO3S |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | sodium dibutylsulfamoyl-[[2,6-di(propan-2-yl)phenyl]carbamoyl]azanide |
| SMILES | CCCCN(CCCC)S(=O)(=O)[N-]C(=O)Nc1c(C(C)C)cccc1C(C)C.[Na+] |
| InChI | InChI=1S/C21H37N3O3S.Na/c1-7-9-14-24(15-10-8-2)28(26,27)23-21(25)22-20-18(16(3)4)12-11-13-19(20)17(5)6;/h11-13,16-17H,7-10,14-15H2,1-6H3,(H2,22,23,25);/q;+1/p-1 |
| InChIKey | ZORKHZPFYKZVNI-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |