C29H53N3O3S — CID 67859948
1-(dioctylsulfamoyl)-3-(2,6-dipropylphenyl)urea (PubChem CID 67859948) has the molecular formula C29H53N3O3S and a molecular weight of 523.83 g/mol. Its IUPAC name is 1-(dioctylsulfamoyl)-3-(2,6-dipropylphenyl)urea.
| Compound Name | 1-(dioctylsulfamoyl)-3-(2,6-dipropylphenyl)urea |
|---|---|
| PubChem CID | 67859948 |
| Molecular Formula | C29H53N3O3S |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | 1-(dioctylsulfamoyl)-3-(2,6-dipropylphenyl)urea |
| SMILES | CCCCCCCCN(CCCCCCCC)S(=O)(=O)NC(=O)Nc1c(CCC)cccc1CCC |
| InChI | InChI=1S/C29H53N3O3S/c1-5-9-11-13-15-17-24-32(25-18-16-14-12-10-6-2)36(34,35)31-29(33)30-28-26(20-7-3)22-19-23-27(28)21-8-4/h19,22-23H,5-18,20-21,24-25H2,1-4H3,(H2,30,31,33) |
| InChIKey | KMEKPXKLNFUPJT-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|