C26H49N5O3S — CID 67830237
1-[2,6-bis(1-amino-5-methylhexyl)phenyl]-3-[butyl(methyl)sulfamoyl]urea (PubChem CID 67830237) has the molecular formula C26H49N5O3S and a molecular weight of 511.78 g/mol. Its IUPAC name is 1-[2,6-bis(1-amino-5-methylhexyl)phenyl]-3-[butyl(methyl)sulfamoyl]urea.
| Compound Name | 1-[2,6-bis(1-amino-5-methylhexyl)phenyl]-3-[butyl(methyl)sulfamoyl]urea |
|---|---|
| PubChem CID | 67830237 |
| Molecular Formula | C26H49N5O3S |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.36 |
| IUPAC Name | 1-[2,6-bis(1-amino-5-methylhexyl)phenyl]-3-[butyl(methyl)sulfamoyl]urea |
| SMILES | CCCCN(C)S(=O)(=O)NC(=O)Nc1c(C(N)CCCC(C)C)cccc1C(N)CCCC(C)C |
| InChI | InChI=1S/C26H49N5O3S/c1-7-8-18-31(6)35(33,34)30-26(32)29-25-21(23(27)16-9-12-19(2)3)14-11-15-22(25)24(28)17-10-13-20(4)5/h11,14-15,19-20,23-24H,7-10,12-13,16-18,27-28H2,1-6H3,(H2,29,30,32) |
| InChIKey | SWYRQSHSFPMMCL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |