C11H15BFNO5 — CID 142785528
[3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid (PubChem CID 142785528) has the molecular formula C11H15BFNO5 and a molecular weight of 271.05 g/mol. Its IUPAC name is [3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid.
| Compound Name | [3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid |
|---|---|
| PubChem CID | 142785528 |
| Molecular Formula | C11H15BFNO5 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid |
| SMILES | CC(C)(C)OC(=O)Nc1c(F)cccc1OB(O)O |
| InChI | InChI=1S/C11H15BFNO5/c1-11(2,3)18-10(15)14-9-7(13)5-4-6-8(9)19-12(16)17/h4-6,16-17H,1-3H3,(H,14,15) |
| InChIKey | GPJOUBPVRFKMCI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|