C13H14FNO2 — CID 162422240
tert-butyl N-(2-ethynyl-3-fluorophenyl)carbamate (PubChem CID 162422240) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is tert-butyl N-(2-ethynyl-3-fluorophenyl)carbamate.
| Compound Name | tert-butyl N-(2-ethynyl-3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 162422240 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | tert-butyl N-(2-ethynyl-3-fluorophenyl)carbamate |
| SMILES | C#Cc1c(F)cccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H14FNO2/c1-5-9-10(14)7-6-8-11(9)15-12(16)17-13(2,3)4/h1,6-8H,2-4H3,(H,15,16) |
| InChIKey | WOIGPWQOZJKGEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|