C19H18FNO2 — CID 87649694
bicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl N-(3-ethynyl-2-fluorophenyl)carbamate (PubChem CID 87649694) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl N-(3-ethynyl-2-fluorophenyl)carbamate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl N-(3-ethynyl-2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 87649694 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl N-(3-ethynyl-2-fluorophenyl)carbamate |
| SMILES | C#Cc1cccc(NC(=O)OC(C)(C)C)c1F.c1cc2cc-2c1 |
| InChI | InChI=1S/C13H14FNO2.C6H4/c1-5-9-7-6-8-10(11(9)14)15-12(16)17-13(2,3)4;1-2-5-4-6(5)3-1/h1,6-8H,2-4H3,(H,15,16);1-4H |
| InChIKey | XLZCBJLIYOSAAD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|