C16H19FN4O2 — CID 107240729
tert-butyl N-[4-fluoro-2-(pyrimidin-4-ylmethylamino)phenyl]carbamate (PubChem CID 107240729) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-2-(pyrimidin-4-ylmethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-2-(pyrimidin-4-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240729 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | tert-butyl N-[4-fluoro-2-(pyrimidin-4-ylmethylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1NCc1ccncn1 |
| InChI | InChI=1S/C16H19FN4O2/c1-16(2,3)23-15(22)21-13-5-4-11(17)8-14(13)19-9-12-6-7-18-10-20-12/h4-8,10,19H,9H2,1-3H3,(H,21,22) |
| InChIKey | GFVAXSULXJYXHO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |