C18H19BrFN3O4 — CID 56571630
tert-butyl N-[2-[[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]amino]-4-fluorophenyl]carbamate (PubChem CID 56571630) has the molecular formula C18H19BrFN3O4 and a molecular weight of 440.27 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]amino]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]amino]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 56571630 |
| Molecular Formula | C18H19BrFN3O4 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | tert-butyl N-[2-[[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]amino]-4-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1NC(=O)Cn1cc(Br)ccc1=O |
| InChI | InChI=1S/C18H19BrFN3O4/c1-18(2,3)27-17(26)22-13-6-5-12(20)8-14(13)21-15(24)10-23-9-11(19)4-7-16(23)25/h4-9H,10H2,1-3H3,(H,21,24)(H,22,26) |
| InChIKey | QIOWRLNDCCGFNK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |