C21H23BrN2O3 — CID 162527171
tert-butyl N-[1-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]-2-cyanoprop-2-enyl]carbamate (PubChem CID 162527171) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is tert-butyl N-[1-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]-2-cyanoprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]-2-cyanoprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 162527171 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | tert-butyl N-[1-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]-2-cyanoprop-2-enyl]carbamate |
| SMILES | C=C(C#N)C(NC(=O)OC(C)(C)C)c1c(COC)ccc2ccc(Br)cc12 |
| InChI | InChI=1S/C21H23BrN2O3/c1-13(11-23)19(24-20(25)27-21(2,3)4)18-15(12-26-5)7-6-14-8-9-16(22)10-17(14)18/h6-10,19H,1,12H2,2-5H3,(H,24,25) |
| InChIKey | PGSADIXUBQJWOK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|