C17H24BrNO4 — CID 155113921
(2S)-5-(4-bromo-2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 155113921) has the molecular formula C17H24BrNO4 and a molecular weight of 386.29 g/mol. Its IUPAC name is (2S)-5-(4-bromo-2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(4-bromo-2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 155113921 |
| Molecular Formula | C17H24BrNO4 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (2S)-5-(4-bromo-2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | Cc1cc(Br)ccc1CCC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H24BrNO4/c1-11-10-13(18)9-8-12(11)6-5-7-14(15(20)21)19-16(22)23-17(2,3)4/h8-10,14H,5-7H2,1-4H3,(H,19,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | KCJQNSGEJBEURV-AWEZNQCLSA-N |
| XLogP | 4.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |