C13H24N4O2 — CID 165457492
tert-butyl N-[1-methyl-5-[(propan-2-ylamino)methyl]pyrazol-3-yl]carbamate (PubChem CID 165457492) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl N-[1-methyl-5-[(propan-2-ylamino)methyl]pyrazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-methyl-5-[(propan-2-ylamino)methyl]pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 165457492 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | tert-butyl N-[1-methyl-5-[(propan-2-ylamino)methyl]pyrazol-3-yl]carbamate |
| SMILES | CC(C)NCc1cc(NC(=O)OC(C)(C)C)nn1C |
| InChI | InChI=1S/C13H24N4O2/c1-9(2)14-8-10-7-11(16-17(10)6)15-12(18)19-13(3,4)5/h7,9,14H,8H2,1-6H3,(H,15,16,18) |
| InChIKey | GZWKSZOTDIPMFJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |