C11H18N4O2S — CID 101332601
tert-butyl N-(6-amino-2-ethylsulfanylpyrimidin-4-yl)carbamate (PubChem CID 101332601) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is tert-butyl N-(6-amino-2-ethylsulfanylpyrimidin-4-yl)carbamate.
| Compound Name | tert-butyl N-(6-amino-2-ethylsulfanylpyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 101332601 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | tert-butyl N-(6-amino-2-ethylsulfanylpyrimidin-4-yl)carbamate |
| SMILES | CCSc1nc(N)cc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C11H18N4O2S/c1-5-18-9-13-7(12)6-8(14-9)15-10(16)17-11(2,3)4/h6H,5H2,1-4H3,(H3,12,13,14,15,16) |
| InChIKey | LYUAKQCATREVKH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |