About tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane
tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane (PubChem CID 142322185) has the molecular formula C18H24F3N3O3
and a molecular weight of 387.40 g/mol. Its IUPAC name is tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane |
| PubChem CID | 142322185 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane |
| SMILES | CC.Cn1nc(NC(=O)OC(C)(C)C)c(OC(F)F)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18F3N3O3.C2H6/c1-16(2,3)25-15(23)20-13-12(24-14(18)19)11(22(4)21-13)9-5-7-10(17)8-6-9;1-2/h5-8,14H,1-4H3,(H,20,21,23);1-2H3 |
| InChIKey | SDNJTRCZNCMIJM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane?
The IUPAC name of tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane (CID 142322185) is tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane is CC.Cn1nc(NC(=O)OC(C)(C)C)c(OC(F)F)c1-c1ccc(F)cc1.
What is the InChIKey of tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane?
The InChIKey is SDNJTRCZNCMIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3O3.C2H6/c1-16(2,3)25-15(23)20-13-12(24-14(18)19)11(22(4)21-13)9-5-7-10(17)8-6-9;1-2/h5-8,14H,1-4H3,(H,20,21,23);1-2H3.
What are the key properties of tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane?
tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane has a molecular weight of 387.40 g/mol, XLogP of 5.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(difluoromethoxy)-5-(4-fluorophenyl)-1-methylpyrazol-3-yl]carbamate;ethane is sourced from PubChem (CID 142322185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).