C10H13N2O2Y- — CID 167499959
tert-butyl N-(2H-pyridin-2-id-5-yl)carbamate;yttrium (PubChem CID 167499959) has the molecular formula C10H13N2O2Y- and a molecular weight of 282.13 g/mol. Its IUPAC name is tert-butyl N-(2H-pyridin-2-id-5-yl)carbamate;yttrium.
| Compound Name | tert-butyl N-(2H-pyridin-2-id-5-yl)carbamate;yttrium |
|---|---|
| PubChem CID | 167499959 |
| Molecular Formula | C10H13N2O2Y- |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | tert-butyl N-(2H-pyridin-2-id-5-yl)carbamate;yttrium |
| SMILES | CC(C)(C)OC(=O)Nc1cc[c-]nc1.[Y] |
| InChI | InChI=1S/C10H13N2O2.Y/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;/h4-5,7H,1-3H3,(H,12,13);/q-1; |
| InChIKey | PSQMFELMUAPVLU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|