C18H19F2N3O5 — CID 171504533
tert-butyl N-[2-[6-(difluoromethoxy)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate (PubChem CID 171504533) has the molecular formula C18H19F2N3O5 and a molecular weight of 395.36 g/mol. Its IUPAC name is tert-butyl N-[2-[6-(difluoromethoxy)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-(difluoromethoxy)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171504533 |
| Molecular Formula | C18H19F2N3O5 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | tert-butyl N-[2-[6-(difluoromethoxy)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate |
| SMILES | COc1cc(OC(F)F)ncc1-c1nccc(NC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C18H19F2N3O5/c1-18(2,3)28-17(25)23-12-5-6-21-15(11(12)9-24)10-8-22-14(27-16(19)20)7-13(10)26-4/h5-9,16H,1-4H3,(H,21,23,25) |
| InChIKey | FHNMZTABQVBCIV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|