C17H18ClN3O4 — CID 171504505
tert-butyl N-[2-(6-chloro-4-methoxy-3-pyridinyl)-3-formyl-4-pyridinyl]carbamate (PubChem CID 171504505) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is tert-butyl N-[2-(6-chloro-4-methoxy-3-pyridinyl)-3-formyl-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-chloro-4-methoxy-3-pyridinyl)-3-formyl-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171504505 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | tert-butyl N-[2-(6-chloro-4-methoxy-3-pyridinyl)-3-formyl-4-pyridinyl]carbamate |
| SMILES | COc1cc(Cl)ncc1-c1nccc(NC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C17H18ClN3O4/c1-17(2,3)25-16(23)21-12-5-6-19-15(11(12)9-22)10-8-20-14(18)7-13(10)24-4/h5-9H,1-4H3,(H,19,21,23) |
| InChIKey | JCQFOLREASHMKS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|