C18H19F2N3O4 — CID 171504618
tert-butyl N-[2-[6-(difluoromethyl)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate (PubChem CID 171504618) has the molecular formula C18H19F2N3O4 and a molecular weight of 379.36 g/mol. Its IUPAC name is tert-butyl N-[2-[6-(difluoromethyl)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-(difluoromethyl)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171504618 |
| Molecular Formula | C18H19F2N3O4 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | tert-butyl N-[2-[6-(difluoromethyl)-4-methoxy-3-pyridinyl]-3-formyl-4-pyridinyl]carbamate |
| SMILES | COc1cc(C(F)F)ncc1-c1nccc(NC(=O)OC(C)(C)C)c1C=O |
| InChI | InChI=1S/C18H19F2N3O4/c1-18(2,3)27-17(25)23-12-5-6-21-15(11(12)9-24)10-8-22-13(16(19)20)7-14(10)26-4/h5-9,16H,1-4H3,(H,21,23,25) |
| InChIKey | LCFNCDFEIPHBIQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|