C21H24BrN3O5 — CID 166521476
tert-butyl N-[5-bromo-6-[3-(1,3-dihydroxyisoindol-2-yl)propoxy]-2-pyridinyl]carbamate (PubChem CID 166521476) has the molecular formula C21H24BrN3O5 and a molecular weight of 478.34 g/mol. Its IUPAC name is tert-butyl N-[5-bromo-6-[3-(1,3-dihydroxyisoindol-2-yl)propoxy]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-bromo-6-[3-(1,3-dihydroxyisoindol-2-yl)propoxy]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166521476 |
| Molecular Formula | C21H24BrN3O5 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | tert-butyl N-[5-bromo-6-[3-(1,3-dihydroxyisoindol-2-yl)propoxy]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Br)c(OCCCn2c(O)c3ccccc3c2O)n1 |
| InChI | InChI=1S/C21H24BrN3O5/c1-21(2,3)30-20(28)24-16-10-9-15(22)17(23-16)29-12-6-11-25-18(26)13-7-4-5-8-14(13)19(25)27/h4-5,7-10,26-27H,6,11-12H2,1-3H3,(H,23,24,28) |
| InChIKey | NIGUFGWUQOUNLN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|