C11H20FN3O2S — CID 142427527
tert-butyl N-(1-fluorosulfanyl-5-methylpyrazol-4-yl)carbamate;ethane (PubChem CID 142427527) has the molecular formula C11H20FN3O2S and a molecular weight of 277.37 g/mol. Its IUPAC name is tert-butyl N-(1-fluorosulfanyl-5-methylpyrazol-4-yl)carbamate;ethane.
| Compound Name | tert-butyl N-(1-fluorosulfanyl-5-methylpyrazol-4-yl)carbamate;ethane |
|---|---|
| PubChem CID | 142427527 |
| Molecular Formula | C11H20FN3O2S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | tert-butyl N-(1-fluorosulfanyl-5-methylpyrazol-4-yl)carbamate;ethane |
| SMILES | CC.Cc1c(NC(=O)OC(C)(C)C)cnn1SF |
| InChI | InChI=1S/C9H14FN3O2S.C2H6/c1-6-7(5-11-13(6)16-10)12-8(14)15-9(2,3)4;1-2/h5H,1-4H3,(H,12,14);1-2H3 |
| InChIKey | MYCSJERJNHYCQM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |