C15H18ClF3N2O4S — CID 67242822
(2R)-2-[2-amino-6-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67242822) has the molecular formula C15H18ClF3N2O4S and a molecular weight of 414.83 g/mol. Its IUPAC name is (2R)-2-[2-amino-6-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-2-[2-amino-6-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67242822 |
| Molecular Formula | C15H18ClF3N2O4S |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (2R)-2-[2-amino-6-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(Sc1c(N)cc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H18ClF3N2O4S/c1-13(2,3)25-12(24)21-14(4,11(22)23)26-10-8(16)5-7(6-9(10)20)15(17,18)19/h5-6H,20H2,1-4H3,(H,21,24)(H,22,23)/t14-/m1/s1 |
| InChIKey | BHAALIJSHMTAPQ-CQSZACIVSA-N |
| XLogP | 4.36 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|