C15H18F3IN2O2 — CID 47085531
N-[3-[2-iodo-5-(trifluoromethyl)anilino]-3-oxopropyl]-2,2-dimethylpropanamide (PubChem CID 47085531) has the molecular formula C15H18F3IN2O2 and a molecular weight of 442.22 g/mol. Its IUPAC name is N-[3-[2-iodo-5-(trifluoromethyl)anilino]-3-oxopropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[2-iodo-5-(trifluoromethyl)anilino]-3-oxopropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 47085531 |
| Molecular Formula | C15H18F3IN2O2 |
| Molecular Weight | 442.22 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[3-[2-iodo-5-(trifluoromethyl)anilino]-3-oxopropyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCC(=O)Nc1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C15H18F3IN2O2/c1-14(2,3)13(23)20-7-6-12(22)21-11-8-9(15(16,17)18)4-5-10(11)19/h4-5,8H,6-7H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | ZSQUDNFHXNJUQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|