C22H19BrN2O4S — CID 46542213
N-[4-[(3-bromobenzoyl)amino]-2-methylphenyl]-3-methylsulfonylbenzamide (PubChem CID 46542213) has the molecular formula C22H19BrN2O4S and a molecular weight of 487.38 g/mol. Its IUPAC name is N-[4-[(3-bromobenzoyl)amino]-2-methylphenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-[(3-bromobenzoyl)amino]-2-methylphenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 46542213 |
| Molecular Formula | C22H19BrN2O4S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N-[4-[(3-bromobenzoyl)amino]-2-methylphenyl]-3-methylsulfonylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(Br)c2)ccc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H19BrN2O4S/c1-14-11-18(24-21(26)15-5-3-7-17(23)12-15)9-10-20(14)25-22(27)16-6-4-8-19(13-16)30(2,28)29/h3-13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | OFPZPGFLKDMHMS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |