C10H9F4NO4S — CID 63037370
2-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]propanoic acid (PubChem CID 63037370) has the molecular formula C10H9F4NO4S and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]propanoic acid.
| Compound Name | 2-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 63037370 |
| Molecular Formula | C10H9F4NO4S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H9F4NO4S/c1-5(9(16)17)20(18,19)15-8-4-6(10(12,13)14)2-3-7(8)11/h2-5,15H,1H3,(H,16,17) |
| InChIKey | ARWOMCWOHVFUHA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |