C14H18F3N3O — CID 103390794
2-[(5-amino-1-methoxypentan-2-yl)amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 103390794) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[(5-amino-1-methoxypentan-2-yl)amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(5-amino-1-methoxypentan-2-yl)amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103390794 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[(5-amino-1-methoxypentan-2-yl)amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | COCC(CCCN)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H18F3N3O/c1-21-9-12(3-2-6-18)20-13-5-4-11(14(15,16)17)7-10(13)8-19/h4-5,7,12,20H,2-3,6,9,18H2,1H3 |
| InChIKey | ILXRBUGGLMQQOB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |