C13H14F3N3 — CID 55100935
2-[2-(cyclopropylamino)ethylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 55100935) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-[2-(cyclopropylamino)ethylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[2-(cyclopropylamino)ethylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 55100935 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[2-(cyclopropylamino)ethylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NCCNC1CC1 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)10-1-4-12(9(7-10)8-17)19-6-5-18-11-2-3-11/h1,4,7,11,18-19H,2-3,5-6H2 |
| InChIKey | MTVCMLIATSXHFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|