C14H16F3N3 — CID 115308102
2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 115308102) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115308102 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CC(CN)(Nc1ccc(C(F)(F)F)cc1C#N)C1CC1 |
| InChI | InChI=1S/C14H16F3N3/c1-13(8-19,10-2-3-10)20-12-5-4-11(14(15,16)17)6-9(12)7-18/h4-6,10,20H,2-3,8,19H2,1H3 |
| InChIKey | LKIFKWVVMCYSQK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |