C13H16N4O2 — CID 115308161
4-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-nitrobenzonitrile (PubChem CID 115308161) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-nitrobenzonitrile.
| Compound Name | 4-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115308161 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-nitrobenzonitrile |
| SMILES | CC(CN)(Nc1ccc(C#N)c([N+](=O)[O-])c1)C1CC1 |
| InChI | InChI=1S/C13H16N4O2/c1-13(8-15,10-3-4-10)16-11-5-2-9(7-14)12(6-11)17(18)19/h2,5-6,10,16H,3-4,8,15H2,1H3 |
| InChIKey | BGORLJPTPCOIMN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|