About 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine
2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine (PubChem CID 113283619) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine |
| PubChem CID | 113283619 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(C)(CN)C2CC2)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-3-6-10(16(17)18)11(14-8)15-12(2,7-13)9-4-5-9/h3,6,9H,4-5,7,13H2,1-2H3,(H,14,15) |
| InChIKey | ZJZQIANLGOZPSN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine?
The IUPAC name of 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine (CID 113283619) is 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine.
What is the SMILES notation for 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine?
The canonical SMILES for 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine is Cc1ccc([N+](=O)[O-])c(NC(C)(CN)C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine?
The InChIKey is ZJZQIANLGOZPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-8-3-6-10(16(17)18)11(14-8)15-12(2,7-13)9-4-5-9/h3,6,9H,4-5,7,13H2,1-2H3,(H,14,15).
What are the key properties of 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine?
2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine has a molecular weight of 250.30 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-N-(6-methyl-3-nitro-2-pyridinyl)propane-1,2-diamine is sourced from PubChem (CID 113283619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).