C13H18N4O2 — CID 115500583
5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzonitrile (PubChem CID 115500583) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzonitrile.
| Compound Name | 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500583 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-nitrobenzonitrile |
| SMILES | CC(C)C(C)(CN)Nc1ccc([N+](=O)[O-])c(C#N)c1 |
| InChI | InChI=1S/C13H18N4O2/c1-9(2)13(3,8-15)16-11-4-5-12(17(18)19)10(6-11)7-14/h4-6,9,16H,8,15H2,1-3H3 |
| InChIKey | NZSGKNFGEMVVTL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|