C15H25N3O3 — CID 115310957
2,3-dimethyl-2-N-(4-nitro-3-propoxyphenyl)butane-1,2-diamine (PubChem CID 115310957) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2,3-dimethyl-2-N-(4-nitro-3-propoxyphenyl)butane-1,2-diamine.
| Compound Name | 2,3-dimethyl-2-N-(4-nitro-3-propoxyphenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 115310957 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2,3-dimethyl-2-N-(4-nitro-3-propoxyphenyl)butane-1,2-diamine |
| SMILES | CCCOc1cc(NC(C)(CN)C(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N3O3/c1-5-8-21-14-9-12(6-7-13(14)18(19)20)17-15(4,10-16)11(2)3/h6-7,9,11,17H,5,8,10,16H2,1-4H3 |
| InChIKey | WTTVTTJYHFFHKR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|