C12H11F3N2O2 — CID 61264554
2-[2-cyano-4-(trifluoromethyl)anilino]-2-methylpropanoic acid (PubChem CID 61264554) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-[2-cyano-4-(trifluoromethyl)anilino]-2-methylpropanoic acid.
| Compound Name | 2-[2-cyano-4-(trifluoromethyl)anilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61264554 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[2-cyano-4-(trifluoromethyl)anilino]-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1ccc(C(F)(F)F)cc1C#N)C(=O)O |
| InChI | InChI=1S/C12H11F3N2O2/c1-11(2,10(18)19)17-9-4-3-8(12(13,14)15)5-7(9)6-16/h3-5,17H,1-2H3,(H,18,19) |
| InChIKey | CGAXRRXGBKVGGO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |