C14H16F3N3O — CID 115693730
2-[2-cyano-4-(trifluoromethyl)anilino]-N,N-diethylacetamide (PubChem CID 115693730) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[2-cyano-4-(trifluoromethyl)anilino]-N,N-diethylacetamide.
| Compound Name | 2-[2-cyano-4-(trifluoromethyl)anilino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 115693730 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[2-cyano-4-(trifluoromethyl)anilino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H16F3N3O/c1-3-20(4-2)13(21)9-19-12-6-5-11(14(15,16)17)7-10(12)8-18/h5-7,19H,3-4,9H2,1-2H3 |
| InChIKey | OQLNTMYFMONPHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |