C12H9F3N2O3 — CID 114898911
3-[2-cyano-4-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898911) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 3-[2-cyano-4-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[2-cyano-4-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114898911 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[2-cyano-4-(trifluoromethyl)anilino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C12H9F3N2O3/c1-6(11(19)20)10(18)17-9-3-2-8(12(13,14)15)4-7(9)5-16/h2-4,6H,1H3,(H,17,18)(H,19,20) |
| InChIKey | DLFQYEFDXWDPTB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|