C13H11F3N4 — CID 82873879
2-[(1-methylpyrazol-3-yl)methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 82873879) has the molecular formula C13H11F3N4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(1-methylpyrazol-3-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 82873879 |
| Molecular Formula | C13H11F3N4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | Cn1ccc(CNc2ccc(C(F)(F)F)cc2C#N)n1 |
| InChI | InChI=1S/C13H11F3N4/c1-20-5-4-11(19-20)8-18-12-3-2-10(13(14,15)16)6-9(12)7-17/h2-6,18H,8H2,1H3 |
| InChIKey | YSGVQJFLPRFERO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |