C18H15N3O — CID 78885590
4-[(4-methoxyphenyl)methylamino]quinoline-3-carbonitrile (PubChem CID 78885590) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methylamino]quinoline-3-carbonitrile.
| Compound Name | 4-[(4-methoxyphenyl)methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 78885590 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-[(4-methoxyphenyl)methylamino]quinoline-3-carbonitrile |
| SMILES | COc1ccc(CNc2c(C#N)cnc3ccccc23)cc1 |
| InChI | InChI=1S/C18H15N3O/c1-22-15-8-6-13(7-9-15)11-21-18-14(10-19)12-20-17-5-3-2-4-16(17)18/h2-9,12H,11H2,1H3,(H,20,21) |
| InChIKey | KLLCAABPPKPILJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |