C20H19N3O — CID 167702626
4-[(4-ethylphenyl)methylamino]-8-methoxyquinoline-3-carbonitrile (PubChem CID 167702626) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)methylamino]-8-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-[(4-ethylphenyl)methylamino]-8-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 167702626 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-[(4-ethylphenyl)methylamino]-8-methoxyquinoline-3-carbonitrile |
| SMILES | CCc1ccc(CNc2c(C#N)cnc3c(OC)cccc23)cc1 |
| InChI | InChI=1S/C20H19N3O/c1-3-14-7-9-15(10-8-14)12-22-19-16(11-21)13-23-20-17(19)5-4-6-18(20)24-2/h4-10,13H,3,12H2,1-2H3,(H,22,23) |
| InChIKey | BLZFWDWYHAZRAJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |