C13H10F3N3O — CID 62189546
4-(ethylamino)-8-(trifluoromethoxy)quinoline-3-carbonitrile (PubChem CID 62189546) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 4-(ethylamino)-8-(trifluoromethoxy)quinoline-3-carbonitrile.
| Compound Name | 4-(ethylamino)-8-(trifluoromethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 62189546 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(ethylamino)-8-(trifluoromethoxy)quinoline-3-carbonitrile |
| SMILES | CCNc1c(C#N)cnc2c(OC(F)(F)F)cccc12 |
| InChI | InChI=1S/C13H10F3N3O/c1-2-18-11-8(6-17)7-19-12-9(11)4-3-5-10(12)20-13(14,15)16/h3-5,7H,2H2,1H3,(H,18,19) |
| InChIKey | YCRYFFNOATYUFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |