C12H9Br2N3 — CID 62188170
6,8-dibromo-4-(ethylamino)quinoline-3-carbonitrile (PubChem CID 62188170) has the molecular formula C12H9Br2N3 and a molecular weight of 355.03 g/mol. Its IUPAC name is 6,8-dibromo-4-(ethylamino)quinoline-3-carbonitrile.
| Compound Name | 6,8-dibromo-4-(ethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 62188170 |
| Molecular Formula | C12H9Br2N3 |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | 6,8-dibromo-4-(ethylamino)quinoline-3-carbonitrile |
| SMILES | CCNc1c(C#N)cnc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C12H9Br2N3/c1-2-16-11-7(5-15)6-17-12-9(11)3-8(13)4-10(12)14/h3-4,6H,2H2,1H3,(H,16,17) |
| InChIKey | QJSGHEOXOVLQCI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |