C18H16ClN3O2 — CID 123132875
8-methoxy-4-(4-methoxyanilino)quinoline-3-carbonitrile;hydrochloride (PubChem CID 123132875) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 8-methoxy-4-(4-methoxyanilino)quinoline-3-carbonitrile;hydrochloride.
| Compound Name | 8-methoxy-4-(4-methoxyanilino)quinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 123132875 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 8-methoxy-4-(4-methoxyanilino)quinoline-3-carbonitrile;hydrochloride |
| SMILES | COc1ccc(Nc2c(C#N)cnc3c(OC)cccc23)cc1.Cl |
| InChI | InChI=1S/C18H15N3O2.ClH/c1-22-14-8-6-13(7-9-14)21-17-12(10-19)11-20-18-15(17)4-3-5-16(18)23-2;/h3-9,11H,1-2H3,(H,20,21);1H |
| InChIKey | VVHIIJDJEYFHHM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |