C18H17N5 — CID 57076882
8-amino-4-[4-(dimethylamino)anilino]quinoline-3-carbonitrile (PubChem CID 57076882) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 8-amino-4-[4-(dimethylamino)anilino]quinoline-3-carbonitrile.
| Compound Name | 8-amino-4-[4-(dimethylamino)anilino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 57076882 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 8-amino-4-[4-(dimethylamino)anilino]quinoline-3-carbonitrile |
| SMILES | CN(C)c1ccc(Nc2c(C#N)cnc3c(N)cccc23)cc1 |
| InChI | InChI=1S/C18H17N5/c1-23(2)14-8-6-13(7-9-14)22-17-12(10-19)11-21-18-15(17)4-3-5-16(18)20/h3-9,11H,20H2,1-2H3,(H,21,22) |
| InChIKey | DKCRQYNOLIDZBN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|