C19H18BrN5 — CID 10135352
6-amino-4-(3-bromoanilino)-8-[(dimethylamino)methyl]quinoline-3-carbonitrile (PubChem CID 10135352) has the molecular formula C19H18BrN5 and a molecular weight of 396.29 g/mol. Its IUPAC name is 6-amino-4-(3-bromoanilino)-8-[(dimethylamino)methyl]quinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(3-bromoanilino)-8-[(dimethylamino)methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10135352 |
| Molecular Formula | C19H18BrN5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 6-amino-4-(3-bromoanilino)-8-[(dimethylamino)methyl]quinoline-3-carbonitrile |
| SMILES | CN(C)Cc1cc(N)cc2c(Nc3cccc(Br)c3)c(C#N)cnc12 |
| InChI | InChI=1S/C19H18BrN5/c1-25(2)11-12-6-15(22)8-17-18(12)23-10-13(9-21)19(17)24-16-5-3-4-14(20)7-16/h3-8,10H,11,22H2,1-2H3,(H,23,24) |
| InChIKey | PFVDWAYDYKHDEH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|