C20H16ClFN4O2 — CID 69258275
6-amino-4-(3-chloro-4-fluoroanilino)-8-(4-hydroxy-3-oxobutyl)quinoline-3-carbonitrile (PubChem CID 69258275) has the molecular formula C20H16ClFN4O2 and a molecular weight of 398.83 g/mol. Its IUPAC name is 6-amino-4-(3-chloro-4-fluoroanilino)-8-(4-hydroxy-3-oxobutyl)quinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(3-chloro-4-fluoroanilino)-8-(4-hydroxy-3-oxobutyl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69258275 |
| Molecular Formula | C20H16ClFN4O2 |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 6-amino-4-(3-chloro-4-fluoroanilino)-8-(4-hydroxy-3-oxobutyl)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(CCC(=O)CO)cc(N)cc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H16ClFN4O2/c21-17-7-14(2-4-18(17)22)26-20-12(8-23)9-25-19-11(1-3-15(28)10-27)5-13(24)6-16(19)20/h2,4-7,9,27H,1,3,10,24H2,(H,25,26) |
| InChIKey | GNGDOCJOBZAVOY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|