C31H29Cl2FN8O2 — CID 138709044
8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-2-hydrazinyl-3-[(2-morpholin-4-yl-2-oxoethyl)amino]-1-phenylprop-2-enyl]amino]quinoline-3-carbonitrile (PubChem CID 138709044) has the molecular formula C31H29Cl2FN8O2 and a molecular weight of 635.53 g/mol. Its IUPAC name is 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-2-hydrazinyl-3-[(2-morpholin-4-yl-2-oxoethyl)amino]-1-phenylprop-2-enyl]amino]quinoline-3-carbonitrile.
| Compound Name | 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-2-hydrazinyl-3-[(2-morpholin-4-yl-2-oxoethyl)amino]-1-phenylprop-2-enyl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 138709044 |
| Molecular Formula | C31H29Cl2FN8O2 |
| Molecular Weight | 635.53 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-2-hydrazinyl-3-[(2-morpholin-4-yl-2-oxoethyl)amino]-1-phenylprop-2-enyl]amino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(Cl)cc(N[C@H](/C(=C/NCC(=O)N3CCOCC3)NN)c3ccccc3)cc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C31H29Cl2FN8O2/c32-24-13-21(6-7-26(24)34)39-29-20(15-35)16-38-31-23(29)12-22(14-25(31)33)40-30(19-4-2-1-3-5-19)27(41-36)17-37-18-28(43)42-8-10-44-11-9-42/h1-7,12-14,16-17,30,37,40-41H,8-11,18,36H2,(H,38,39)/b27-17-/t30-/m0/s1 |
| InChIKey | JAXUATUJXSULTO-OGEXXFCLSA-N |
| XLogP | 5.20 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|