C30H28Cl2F2N8 — CID 155330142
8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-1-(4-fluorophenyl)-2-hydrazinyl-3-(piperidin-4-ylamino)prop-2-enyl]amino]quinoline-3-carbonitrile (PubChem CID 155330142) has the molecular formula C30H28Cl2F2N8 and a molecular weight of 609.51 g/mol. Its IUPAC name is 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-1-(4-fluorophenyl)-2-hydrazinyl-3-(piperidin-4-ylamino)prop-2-enyl]amino]quinoline-3-carbonitrile.
| Compound Name | 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-1-(4-fluorophenyl)-2-hydrazinyl-3-(piperidin-4-ylamino)prop-2-enyl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 155330142 |
| Molecular Formula | C30H28Cl2F2N8 |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[(Z,1S)-1-(4-fluorophenyl)-2-hydrazinyl-3-(piperidin-4-ylamino)prop-2-enyl]amino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(Cl)cc(N[C@H](/C(=C/NC3CCNCC3)NN)c3ccc(F)cc3)cc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C30H28Cl2F2N8/c31-24-12-21(5-6-26(24)34)40-28-18(14-35)15-39-30-23(28)11-22(13-25(30)32)41-29(17-1-3-19(33)4-2-17)27(42-36)16-38-20-7-9-37-10-8-20/h1-6,11-13,15-16,20,29,37-38,41-42H,7-10,36H2,(H,39,40)/b27-16-/t29-/m0/s1 |
| InChIKey | FCQZHTQTUZSHFW-VPHSIRQSSA-N |
| XLogP | 6.23 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|