C16H13F2N3 — CID 103963319
4-N-[(2,5-difluorophenyl)methyl]quinoline-3,4-diamine (PubChem CID 103963319) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-N-[(2,5-difluorophenyl)methyl]quinoline-3,4-diamine.
| Compound Name | 4-N-[(2,5-difluorophenyl)methyl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963319 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-N-[(2,5-difluorophenyl)methyl]quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2N3/c17-11-5-6-13(18)10(7-11)8-21-16-12-3-1-2-4-15(12)20-9-14(16)19/h1-7,9H,8,19H2,(H,20,21) |
| InChIKey | GYCYPGMSYWNCBM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |