C15H10F3N3 — CID 103963244
4-N-(2,3,5-trifluorophenyl)quinoline-3,4-diamine (PubChem CID 103963244) has the molecular formula C15H10F3N3 and a molecular weight of 289.26 g/mol. Its IUPAC name is 4-N-(2,3,5-trifluorophenyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2,3,5-trifluorophenyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963244 |
| Molecular Formula | C15H10F3N3 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-N-(2,3,5-trifluorophenyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C15H10F3N3/c16-8-5-10(17)14(18)13(6-8)21-15-9-3-1-2-4-12(9)20-7-11(15)19/h1-7H,19H2,(H,20,21) |
| InChIKey | GEUWYKKUDKEUHW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|