C15H11ClIN3 — CID 107606277
4-N-(2-chloro-4-iodophenyl)quinoline-3,4-diamine (PubChem CID 107606277) has the molecular formula C15H11ClIN3 and a molecular weight of 395.63 g/mol. Its IUPAC name is 4-N-(2-chloro-4-iodophenyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2-chloro-4-iodophenyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 107606277 |
| Molecular Formula | C15H11ClIN3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 4-N-(2-chloro-4-iodophenyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C15H11ClIN3/c16-11-7-9(17)5-6-14(11)20-15-10-3-1-2-4-13(10)19-8-12(15)18/h1-8H,18H2,(H,19,20) |
| InChIKey | JLJXVGVDMULIDB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|