C16H9F2N3 — CID 61077022
4-(2,3-difluoroanilino)quinoline-3-carbonitrile (PubChem CID 61077022) has the molecular formula C16H9F2N3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(2,3-difluoroanilino)quinoline-3-carbonitrile.
| Compound Name | 4-(2,3-difluoroanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 61077022 |
| Molecular Formula | C16H9F2N3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(2,3-difluoroanilino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1Nc1cccc(F)c1F |
| InChI | InChI=1S/C16H9F2N3/c17-12-5-3-7-14(15(12)18)21-16-10(8-19)9-20-13-6-2-1-4-11(13)16/h1-7,9H,(H,20,21) |
| InChIKey | LTVSWRWDYPBEQV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |